C24H29ClO8 — CID 2753099
tetramethyl 9-(chloromethyl)-10-methyl-1,2,3,4,5,6,7,8-octahydroanthracene-2,3,6,7-tetracarboxylate (PubChem CID 2753099) has the molecular formula C24H29ClO8 and a molecular weight of 480.94 g/mol. Its IUPAC name is tetramethyl 9-(chloromethyl)-10-methyl-1,2,3,4,5,6,7,8-octahydroanthracene-2,3,6,7-tetracarboxylate.
| Compound Name | tetramethyl 9-(chloromethyl)-10-methyl-1,2,3,4,5,6,7,8-octahydroanthracene-2,3,6,7-tetracarboxylate |
|---|---|
| PubChem CID | 2753099 |
| Molecular Formula | C24H29ClO8 |
| Molecular Weight | 480.94 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | tetramethyl 9-(chloromethyl)-10-methyl-1,2,3,4,5,6,7,8-octahydroanthracene-2,3,6,7-tetracarboxylate |
| SMILES | COC(=O)C1Cc2c(C)c3c(c(CCl)c2CC1C(=O)OC)CC(C(=O)OC)C(C(=O)OC)C3 |
| InChI | InChI=1S/C24H29ClO8/c1-11-12-6-16(21(26)30-2)18(23(28)32-4)8-14(12)20(10-25)15-9-19(24(29)33-5)17(7-13(11)15)22(27)31-3/h16-19H,6-10H2,1-5H3 |
| InChIKey | UVSGDGDKCNUPQO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.94 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|