About (2-methylphenyl)methyl thiocyanate
(2-methylphenyl)methyl thiocyanate (PubChem CID 2753148) has the molecular formula C9H9NS
and a molecular weight of 163.24 g/mol. Its IUPAC name is (2-methylphenyl)methyl thiocyanate.
Molecular Properties
| Compound Name | (2-methylphenyl)methyl thiocyanate |
| PubChem CID | 2753148 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | (2-methylphenyl)methyl thiocyanate |
| SMILES | Cc1ccccc1CSC#N |
| InChI | InChI=1S/C9H9NS/c1-8-4-2-3-5-9(8)6-11-7-10/h2-5H,6H2,1H3 |
| InChIKey | TXIRPFGRGWWMSB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl)methyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl)methyl thiocyanate?
The IUPAC name of (2-methylphenyl)methyl thiocyanate (CID 2753148) is (2-methylphenyl)methyl thiocyanate.
What is the SMILES notation for (2-methylphenyl)methyl thiocyanate?
The canonical SMILES for (2-methylphenyl)methyl thiocyanate is Cc1ccccc1CSC#N.
What is the InChIKey of (2-methylphenyl)methyl thiocyanate?
The InChIKey is TXIRPFGRGWWMSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NS/c1-8-4-2-3-5-9(8)6-11-7-10/h2-5H,6H2,1H3.
What are the key properties of (2-methylphenyl)methyl thiocyanate?
(2-methylphenyl)methyl thiocyanate has a molecular weight of 163.24 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl)methyl thiocyanate is sourced from PubChem (CID 2753148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).