About 2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene
2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene (PubChem CID 2753184) has the molecular formula C8H2Br4S2
and a molecular weight of 481.85 g/mol. Its IUPAC name is 2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene.
Molecular Properties
| Compound Name | 2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene |
| PubChem CID | 2753184 |
| Molecular Formula | C8H2Br4S2 |
| Molecular Weight | 481.85 g/mol |
| Exact Mass | 477.63 |
| IUPAC Name | 2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene |
| SMILES | Brc1cc(-c2cc(Br)c(Br)s2)sc1Br |
| InChI | InChI=1S/C8H2Br4S2/c9-3-1-5(13-7(3)11)6-2-4(10)8(12)14-6/h1-2H |
| InChIKey | BFEVWSRLCFSTRU-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.85 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene?
The IUPAC name of 2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene (CID 2753184) is 2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene.
What is the SMILES notation for 2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene?
The canonical SMILES for 2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene is Brc1cc(-c2cc(Br)c(Br)s2)sc1Br.
What is the InChIKey of 2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene?
The InChIKey is BFEVWSRLCFSTRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2Br4S2/c9-3-1-5(13-7(3)11)6-2-4(10)8(12)14-6/h1-2H.
What are the key properties of 2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene?
2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene has a molecular weight of 481.85 g/mol, XLogP of 6.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-5-(4,5-dibromothiophen-2-yl)thiophene is sourced from PubChem (CID 2753184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).