C17H20F2N2O3 — CID 27532550
2-[5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 27532550) has the molecular formula C17H20F2N2O3 and a molecular weight of 338.35 g/mol. Its IUPAC name is 2-[5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 27532550 |
| Molecular Formula | C17H20F2N2O3 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | CC(C)OCCCNC(=O)Cc1cc(-c2ccc(F)cc2F)on1 |
| InChI | InChI=1S/C17H20F2N2O3/c1-11(2)23-7-3-6-20-17(22)10-13-9-16(24-21-13)14-5-4-12(18)8-15(14)19/h4-5,8-9,11H,3,6-7,10H2,1-2H3,(H,20,22) |
| InChIKey | NGPXZEDNAKALBQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|