C5H6N2S — CID 2753356
4,6-dihydro-1H-thieno[3,4-d]pyrazole (PubChem CID 2753356) has the molecular formula C5H6N2S and a molecular weight of 126.18 g/mol. Its IUPAC name is 4,6-dihydro-1H-thieno[3,4-d]pyrazole.
| Compound Name | 4,6-dihydro-1H-thieno[3,4-d]pyrazole |
|---|---|
| PubChem CID | 2753356 |
| Molecular Formula | C5H6N2S |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 4,6-dihydro-1H-thieno[3,4-d]pyrazole |
| SMILES | c1n[nH]c2c1CSC2 |
| InChI | InChI=1S/C5H6N2S/c1-4-2-8-3-5(4)7-6-1/h1H,2-3H2,(H,6,7) |
| InChIKey | WFUOVUVQGMHJCW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |