C21H27N3O4 — CID 27535607
N-(2,6-dimethylphenyl)-2-[2-(2-methoxyphenoxy)ethylcarbamoyl-methylamino]acetamide (PubChem CID 27535607) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[2-(2-methoxyphenoxy)ethylcarbamoyl-methylamino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[2-(2-methoxyphenoxy)ethylcarbamoyl-methylamino]acetamide |
|---|---|
| PubChem CID | 27535607 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[2-(2-methoxyphenoxy)ethylcarbamoyl-methylamino]acetamide |
| SMILES | COc1ccccc1OCCNC(=O)N(C)CC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C21H27N3O4/c1-15-8-7-9-16(2)20(15)23-19(25)14-24(3)21(26)22-12-13-28-18-11-6-5-10-17(18)27-4/h5-11H,12-14H2,1-4H3,(H,22,26)(H,23,25) |
| InChIKey | MMZPHJVJWSQEEN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|