C12H12N2OS2 — CID 27537384
N-cyclopropyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 27537384) has the molecular formula C12H12N2OS2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N-cyclopropyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-cyclopropyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 27537384 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | N-cyclopropyl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(-c2cccs2)n1)NC1CC1 |
| InChI | InChI=1S/C12H12N2OS2/c15-11(13-8-3-4-8)6-9-7-17-12(14-9)10-2-1-5-16-10/h1-2,5,7-8H,3-4,6H2,(H,13,15) |
| InChIKey | JKJXTNCKIIGIKT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |