C28H36N2O3 — CID 27537839
1-[(6S,6aS,7S)-7-hydroxy-6-(2-methoxyphenyl)-9,9-dimethyl-6a,7,8,10-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl]hexan-1-one (PubChem CID 27537839) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is 1-[(6S,6aS,7S)-7-hydroxy-6-(2-methoxyphenyl)-9,9-dimethyl-6a,7,8,10-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl]hexan-1-one.
| Compound Name | 1-[(6S,6aS,7S)-7-hydroxy-6-(2-methoxyphenyl)-9,9-dimethyl-6a,7,8,10-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl]hexan-1-one |
|---|---|
| PubChem CID | 27537839 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 1-[(6S,6aS,7S)-7-hydroxy-6-(2-methoxyphenyl)-9,9-dimethyl-6a,7,8,10-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1c2ccccc2N=C2CC(C)(C)C[C@H](O)[C@H]2[C@H]1c1ccccc1OC |
| InChI | InChI=1S/C28H36N2O3/c1-5-6-7-16-25(32)30-22-14-10-9-13-20(22)29-21-17-28(2,3)18-23(31)26(21)27(30)19-12-8-11-15-24(19)33-4/h8-15,23,26-27,31H,5-7,16-18H2,1-4H3/t23-,26-,27+/m0/s1 |
| InChIKey | ASEVQPKUGBNXIJ-MSLLRLGPSA-N |
| XLogP | 6.23 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|