About N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine
N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine (PubChem CID 2753971) has the molecular formula C19H23NO3
and a molecular weight of 313.40 g/mol. Its IUPAC name is N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine.
Molecular Properties
| Compound Name | N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine |
| PubChem CID | 2753971 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine |
| SMILES | CC1(C)OC[C@H]([C@H](c2ccccc2)N(O)Cc2ccccc2)O1 |
| InChI | InChI=1S/C19H23NO3/c1-19(2)22-14-17(23-19)18(16-11-7-4-8-12-16)20(21)13-15-9-5-3-6-10-15/h3-12,17-18,21H,13-14H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | IHVMYGDTMWXZQI-MSOLQXFVSA-N |
| XLogP | 3.77 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine?
The IUPAC name of N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine (CID 2753971) is N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine.
What is the SMILES notation for N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine?
The canonical SMILES for N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine is CC1(C)OC[C@H]([C@H](c2ccccc2)N(O)Cc2ccccc2)O1.
What is the InChIKey of N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine?
The InChIKey is IHVMYGDTMWXZQI-MSOLQXFVSA-N. The full InChI is InChI=1S/C19H23NO3/c1-19(2)22-14-17(23-19)18(16-11-7-4-8-12-16)20(21)13-15-9-5-3-6-10-15/h3-12,17-18,21H,13-14H2,1-2H3/t17-,18+/m1/s1.
What are the key properties of N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine?
N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine has a molecular weight of 313.40 g/mol, XLogP of 3.77, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[(S)-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl]hydroxylamine is sourced from PubChem (CID 2753971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).