About 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one
3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 27540236) has the molecular formula C25H20N2O3S
and a molecular weight of 428.51 g/mol. Its IUPAC name is 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 27540236 |
| Molecular Formula | C25H20N2O3S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc2oc(=O)cc(Cn3cnc4sc(-c5ccccc5)c(C)c4c3=O)c2cc1C |
| InChI | InChI=1S/C25H20N2O3S/c1-14-9-19-18(11-21(28)30-20(19)10-15(14)2)12-27-13-26-24-22(25(27)29)16(3)23(31-24)17-7-5-4-6-8-17/h4-11,13H,12H2,1-3H3 |
| InChIKey | PDGRWVFZQBVXFS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one (CID 27540236) is 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one is Cc1cc2oc(=O)cc(Cn3cnc4sc(-c5ccccc5)c(C)c4c3=O)c2cc1C.
What is the InChIKey of 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one?
The InChIKey is PDGRWVFZQBVXFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N2O3S/c1-14-9-19-18(11-21(28)30-20(19)10-15(14)2)12-27-13-26-24-22(25(27)29)16(3)23(31-24)17-7-5-4-6-8-17/h4-11,13H,12H2,1-3H3.
What are the key properties of 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one?
3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one has a molecular weight of 428.51 g/mol, XLogP of 5.20, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-methyl-6-phenylthieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 27540236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).