C11H6BrNO4 — CID 2754053
7-bromo-6-methyl-1H-pyrano[2,3-e][1,3]benzoxazole-2,8-dione (PubChem CID 2754053) has the molecular formula C11H6BrNO4 and a molecular weight of 296.08 g/mol. Its IUPAC name is 7-bromo-6-methyl-1H-pyrano[2,3-e][1,3]benzoxazole-2,8-dione.
| Compound Name | 7-bromo-6-methyl-1H-pyrano[2,3-e][1,3]benzoxazole-2,8-dione |
|---|---|
| PubChem CID | 2754053 |
| Molecular Formula | C11H6BrNO4 |
| Molecular Weight | 296.08 g/mol |
| Exact Mass | 294.95 |
| IUPAC Name | 7-bromo-6-methyl-1H-pyrano[2,3-e][1,3]benzoxazole-2,8-dione |
| SMILES | Cc1c(Br)c(=O)oc2c1ccc1oc(=O)[nH]c12 |
| InChI | InChI=1S/C11H6BrNO4/c1-4-5-2-3-6-8(13-11(15)16-6)9(5)17-10(14)7(4)12/h2-3H,1H3,(H,13,15) |
| InChIKey | JLZBEHQHLTYKRW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.08 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|