C21H34O3 — CID 2754122
1-[(3S,5S,10S,13S,17S)-3,17-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethanone (PubChem CID 2754122) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 1-[(3S,5S,10S,13S,17S)-3,17-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethanone.
| Compound Name | 1-[(3S,5S,10S,13S,17S)-3,17-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethanone |
|---|---|
| PubChem CID | 2754122 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 1-[(3S,5S,10S,13S,17S)-3,17-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethanone |
| SMILES | CC(=O)[C@]1(O)CC[C@]2(C)C3CC[C@@]4(C)C(CC[C@@H]4O)C3CC[C@H]2C1 |
| InChI | InChI=1S/C21H34O3/c1-13(22)21(24)11-10-19(2)14(12-21)4-5-15-16-6-7-18(23)20(16,3)9-8-17(15)19/h14-18,23-24H,4-12H2,1-3H3/t14-,15?,16?,17?,18-,19-,20-,21-/m0/s1 |
| InChIKey | JSZXWENPVDSORI-REXZIAPVSA-N |
| XLogP | 3.71 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |