C21H23N3O5S — CID 27542218
[2-(benzylcarbamoylamino)-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate (PubChem CID 27542218) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate.
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 27542218 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 1-(thiophene-2-carbonyl)piperidine-4-carboxylate |
| SMILES | O=C(COC(=O)C1CCN(C(=O)c2cccs2)CC1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H23N3O5S/c25-18(23-21(28)22-13-15-5-2-1-3-6-15)14-29-20(27)16-8-10-24(11-9-16)19(26)17-7-4-12-30-17/h1-7,12,16H,8-11,13-14H2,(H2,22,23,25,28) |
| InChIKey | YCRMJPFHJSQGAK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |