C21H16BrFN2O3 — CID 27543583
ethyl (4R)-6-amino-4-(5-bromo-2-fluorophenyl)-5-cyano-2-phenyl-4H-pyran-3-carboxylate (PubChem CID 27543583) has the molecular formula C21H16BrFN2O3 and a molecular weight of 443.27 g/mol. Its IUPAC name is ethyl (4R)-6-amino-4-(5-bromo-2-fluorophenyl)-5-cyano-2-phenyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl (4R)-6-amino-4-(5-bromo-2-fluorophenyl)-5-cyano-2-phenyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 27543583 |
| Molecular Formula | C21H16BrFN2O3 |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | ethyl (4R)-6-amino-4-(5-bromo-2-fluorophenyl)-5-cyano-2-phenyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)OC(N)=C(C#N)[C@H]1c1cc(Br)ccc1F |
| InChI | InChI=1S/C21H16BrFN2O3/c1-2-27-21(26)18-17(14-10-13(22)8-9-16(14)23)15(11-24)20(25)28-19(18)12-6-4-3-5-7-12/h3-10,17H,2,25H2,1H3/t17-/m1/s1 |
| InChIKey | NYHIUOIDSVZVPC-QGZVFWFLSA-N |
| XLogP | 4.37 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |