About 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine
8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine (PubChem CID 2754456) has the molecular formula C11H11N5
and a molecular weight of 213.24 g/mol. Its IUPAC name is 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine.
Molecular Properties
| Compound Name | 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine |
| PubChem CID | 2754456 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine |
| SMILES | Cc1cc2c(ccc3nc(N)nc(N)c32)[nH]1 |
| InChI | InChI=1S/C11H11N5/c1-5-4-6-7(14-5)2-3-8-9(6)10(12)16-11(13)15-8/h2-4,14H,1H3,(H4,12,13,15,16) |
| InChIKey | TVZWUWIEIFOOSS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine?
The IUPAC name of 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine (CID 2754456) is 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine.
What is the SMILES notation for 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine?
The canonical SMILES for 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine is Cc1cc2c(ccc3nc(N)nc(N)c32)[nH]1.
What is the InChIKey of 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine?
The InChIKey is TVZWUWIEIFOOSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5/c1-5-4-6-7(14-5)2-3-8-9(6)10(12)16-11(13)15-8/h2-4,14H,1H3,(H4,12,13,15,16).
What are the key properties of 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine?
8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine has a molecular weight of 213.24 g/mol, XLogP of 1.58, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine is sourced from PubChem (CID 2754456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).