About 3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione
3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione (PubChem CID 2754474) has the molecular formula C15H8ClN3O2S
and a molecular weight of 329.77 g/mol. Its IUPAC name is 3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione |
| PubChem CID | 2754474 |
| Molecular Formula | C15H8ClN3O2S |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1-c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C15H8ClN3O2S/c16-9-5-3-7-11-12(9)18-15(22-11)19-13(20)8-4-1-2-6-10(8)17-14(19)21/h1-7H,(H,17,21) |
| InChIKey | BRYLFCKWVRQFPH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione?
The IUPAC name of 3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione (CID 2754474) is 3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione.
What is the SMILES notation for 3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione?
The canonical SMILES for 3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione is O=c1[nH]c2ccccc2c(=O)n1-c1nc2c(Cl)cccc2s1.
What is the InChIKey of 3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione?
The InChIKey is BRYLFCKWVRQFPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8ClN3O2S/c16-9-5-3-7-11-12(9)18-15(22-11)19-13(20)8-4-1-2-6-10(8)17-14(19)21/h1-7H,(H,17,21).
What are the key properties of 3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione?
3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione has a molecular weight of 329.77 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-1,3-benzothiazol-2-yl)-1H-quinazoline-2,4-dione is sourced from PubChem (CID 2754474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).