About 6,7-dibromo-2,3-dihydro-1,4-benzodioxine
6,7-dibromo-2,3-dihydro-1,4-benzodioxine (PubChem CID 2754502) has the molecular formula C8H6Br2O2
and a molecular weight of 293.94 g/mol. Its IUPAC name is 6,7-dibromo-2,3-dihydro-1,4-benzodioxine.
Molecular Properties
| Compound Name | 6,7-dibromo-2,3-dihydro-1,4-benzodioxine |
| PubChem CID | 2754502 |
| Molecular Formula | C8H6Br2O2 |
| Molecular Weight | 293.94 g/mol |
| Exact Mass | 291.87 |
| IUPAC Name | 6,7-dibromo-2,3-dihydro-1,4-benzodioxine |
| SMILES | Brc1cc2c(cc1Br)OCCO2 |
| InChI | InChI=1S/C8H6Br2O2/c9-5-3-7-8(4-6(5)10)12-2-1-11-7/h3-4H,1-2H2 |
| InChIKey | FTSJTAIEXFMURW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.94 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dibromo-2,3-dihydro-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dibromo-2,3-dihydro-1,4-benzodioxine?
The IUPAC name of 6,7-dibromo-2,3-dihydro-1,4-benzodioxine (CID 2754502) is 6,7-dibromo-2,3-dihydro-1,4-benzodioxine.
What is the SMILES notation for 6,7-dibromo-2,3-dihydro-1,4-benzodioxine?
The canonical SMILES for 6,7-dibromo-2,3-dihydro-1,4-benzodioxine is Brc1cc2c(cc1Br)OCCO2.
What is the InChIKey of 6,7-dibromo-2,3-dihydro-1,4-benzodioxine?
The InChIKey is FTSJTAIEXFMURW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Br2O2/c9-5-3-7-8(4-6(5)10)12-2-1-11-7/h3-4H,1-2H2.
What are the key properties of 6,7-dibromo-2,3-dihydro-1,4-benzodioxine?
6,7-dibromo-2,3-dihydro-1,4-benzodioxine has a molecular weight of 293.94 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dibromo-2,3-dihydro-1,4-benzodioxine is sourced from PubChem (CID 2754502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).