C7H8F3N5O3S — CID 2754701
ethyl N-[[5-sulfanylidene-3-(trifluoromethyl)-1H-1,2,4-triazol-4-yl]carbamoyl]carbamate (PubChem CID 2754701) has the molecular formula C7H8F3N5O3S and a molecular weight of 299.23 g/mol. Its IUPAC name is ethyl N-[[5-sulfanylidene-3-(trifluoromethyl)-1H-1,2,4-triazol-4-yl]carbamoyl]carbamate.
| Compound Name | ethyl N-[[5-sulfanylidene-3-(trifluoromethyl)-1H-1,2,4-triazol-4-yl]carbamoyl]carbamate |
|---|---|
| PubChem CID | 2754701 |
| Molecular Formula | C7H8F3N5O3S |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | ethyl N-[[5-sulfanylidene-3-(trifluoromethyl)-1H-1,2,4-triazol-4-yl]carbamoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)Nn1c(C(F)(F)F)n[nH]c1=S |
| InChI | InChI=1S/C7H8F3N5O3S/c1-2-18-6(17)11-4(16)14-15-3(7(8,9)10)12-13-5(15)19/h2H2,1H3,(H,13,19)(H2,11,14,16,17) |
| InChIKey | UHDCXGXHMJMBLQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|