C25H27N3O5S — CID 27548773
4-[[(4-acetamidophenyl)sulfonylamino]methyl]-N-[2-(4-methoxyphenyl)ethyl]benzamide (PubChem CID 27548773) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is 4-[[(4-acetamidophenyl)sulfonylamino]methyl]-N-[2-(4-methoxyphenyl)ethyl]benzamide.
| Compound Name | 4-[[(4-acetamidophenyl)sulfonylamino]methyl]-N-[2-(4-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 27548773 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 4-[[(4-acetamidophenyl)sulfonylamino]methyl]-N-[2-(4-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(CNS(=O)(=O)c3ccc(NC(C)=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O5S/c1-18(29)28-22-9-13-24(14-10-22)34(31,32)27-17-20-3-7-21(8-4-20)25(30)26-16-15-19-5-11-23(33-2)12-6-19/h3-14,27H,15-17H2,1-2H3,(H,26,30)(H,28,29) |
| InChIKey | XXYZOUYSWXXCPR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |