About 4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole
4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole (PubChem CID 2755088) has the molecular formula C14H13NOS2
and a molecular weight of 275.40 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole |
| PubChem CID | 2755088 |
| Molecular Formula | C14H13NOS2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole |
| SMILES | C(=Cc1nc(C2SCCS2)co1)c1ccccc1 |
| InChI | InChI=1S/C14H13NOS2/c1-2-4-11(5-3-1)6-7-13-15-12(10-16-13)14-17-8-9-18-14/h1-7,10,14H,8-9H2 |
| InChIKey | QSWOPCUIRVERJI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole?
The IUPAC name of 4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole (CID 2755088) is 4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole.
What is the SMILES notation for 4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole?
The canonical SMILES for 4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole is C(=Cc1nc(C2SCCS2)co1)c1ccccc1.
What is the InChIKey of 4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole?
The InChIKey is QSWOPCUIRVERJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NOS2/c1-2-4-11(5-3-1)6-7-13-15-12(10-16-13)14-17-8-9-18-14/h1-7,10,14H,8-9H2.
What are the key properties of 4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole?
4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole has a molecular weight of 275.40 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dithiolan-2-yl)-2-(2-phenylethenyl)-1,3-oxazole is sourced from PubChem (CID 2755088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).