About 2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one
2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one (PubChem CID 2755148) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one.
Analyze 2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one?
The IUPAC name of 2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one (CID 2755148) is 2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for 2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one?
The canonical SMILES for 2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one is Cc1ccc(O)c(O)c(=O)c1.
What is the InChIKey of 2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one?
The InChIKey is LTYPWDAORXWBGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c1-5-2-3-6(9)8(11)7(10)4-5/h2-4H,1H3,(H2,9,10,11).
What are the key properties of 2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one?
2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one has a molecular weight of 152.15 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 2755148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).