C10H15NO6 — CID 2755173
1-(aminomethyl)-8-oxabicyclo[3.2.1]octan-3-one;oxalic acid (PubChem CID 2755173) has the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. Its IUPAC name is 1-(aminomethyl)-8-oxabicyclo[3.2.1]octan-3-one;oxalic acid.
| Compound Name | 1-(aminomethyl)-8-oxabicyclo[3.2.1]octan-3-one;oxalic acid |
|---|---|
| PubChem CID | 2755173 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 1-(aminomethyl)-8-oxabicyclo[3.2.1]octan-3-one;oxalic acid |
| SMILES | NCC12CCC(CC(=O)C1)O2.O=C(O)C(=O)O |
| InChI | InChI=1S/C8H13NO2.C2H2O4/c9-5-8-2-1-7(11-8)3-6(10)4-8;3-1(4)2(5)6/h7H,1-5,9H2;(H,3,4)(H,5,6) |
| InChIKey | GUCBTVZSIMZKEA-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|