About N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine
N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine (PubChem CID 2755344) has the molecular formula C19H25N5
and a molecular weight of 323.44 g/mol. Its IUPAC name is N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine.
Molecular Properties
| Compound Name | N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine |
| PubChem CID | 2755344 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine |
| SMILES | Cc1cc(C)n(CN(Cc2ccccc2)Cn2nc(C)cc2C)n1 |
| InChI | InChI=1S/C19H25N5/c1-15-10-17(3)23(20-15)13-22(12-19-8-6-5-7-9-19)14-24-18(4)11-16(2)21-24/h5-11H,12-14H2,1-4H3 |
| InChIKey | VFYVMLJDHYLKBD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine?
The IUPAC name of N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine (CID 2755344) is N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine.
What is the SMILES notation for N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine?
The canonical SMILES for N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine is Cc1cc(C)n(CN(Cc2ccccc2)Cn2nc(C)cc2C)n1.
What is the InChIKey of N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine?
The InChIKey is VFYVMLJDHYLKBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N5/c1-15-10-17(3)23(20-15)13-22(12-19-8-6-5-7-9-19)14-24-18(4)11-16(2)21-24/h5-11H,12-14H2,1-4H3.
What are the key properties of N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine?
N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine has a molecular weight of 323.44 g/mol, XLogP of 3.43, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1-phenylmethanamine is sourced from PubChem (CID 2755344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).