C20H15BrClNO4 — CID 27554126
ethyl (1R,5R,6R)-3-(4-bromophenyl)-1-(4-chlorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 27554126) has the molecular formula C20H15BrClNO4 and a molecular weight of 448.70 g/mol. Its IUPAC name is ethyl (1R,5R,6R)-3-(4-bromophenyl)-1-(4-chlorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | ethyl (1R,5R,6R)-3-(4-bromophenyl)-1-(4-chlorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 27554126 |
| Molecular Formula | C20H15BrClNO4 |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 446.99 |
| IUPAC Name | ethyl (1R,5R,6R)-3-(4-bromophenyl)-1-(4-chlorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C(=O)N(c3ccc(Br)cc3)C(=O)[C@@]12c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15BrClNO4/c1-2-27-18(25)16-15-17(24)23(14-9-5-12(21)6-10-14)19(26)20(15,16)11-3-7-13(22)8-4-11/h3-10,15-16H,2H2,1H3/t15-,16-,20+/m0/s1 |
| InChIKey | CCPRXSMQSZTWCJ-TWOQFEAHSA-N |
| XLogP | 3.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|