C15H26O2 — CID 2755505
4-hydroxy-3,3-dimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pentan-2-one (PubChem CID 2755505) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 4-hydroxy-3,3-dimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pentan-2-one.
| Compound Name | 4-hydroxy-3,3-dimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pentan-2-one |
|---|---|
| PubChem CID | 2755505 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 4-hydroxy-3,3-dimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pentan-2-one |
| SMILES | CC(=O)C(C)(C)C(O)CC1CC=C(C)C1(C)C |
| InChI | InChI=1S/C15H26O2/c1-10-7-8-12(14(10,3)4)9-13(17)15(5,6)11(2)16/h7,12-13,17H,8-9H2,1-6H3 |
| InChIKey | ONECILGFBWGHTE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|