About 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine
5-benzylsulfanyl-1,2,4-thiadiazol-3-amine (PubChem CID 2756351) has the molecular formula C9H9N3S2
and a molecular weight of 223.33 g/mol. Its IUPAC name is 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine.
Molecular Properties
| Compound Name | 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine |
| PubChem CID | 2756351 |
| Molecular Formula | C9H9N3S2 |
| Molecular Weight | 223.33 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine |
| SMILES | Nc1nsc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C9H9N3S2/c10-8-11-9(14-12-8)13-6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,12) |
| InChIKey | VTSHLDJUHMNAIL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine?
The IUPAC name of 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine (CID 2756351) is 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine.
What is the SMILES notation for 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine?
The canonical SMILES for 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine is Nc1nsc(SCc2ccccc2)n1.
What is the InChIKey of 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine?
The InChIKey is VTSHLDJUHMNAIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3S2/c10-8-11-9(14-12-8)13-6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,12).
What are the key properties of 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine?
5-benzylsulfanyl-1,2,4-thiadiazol-3-amine has a molecular weight of 223.33 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzylsulfanyl-1,2,4-thiadiazol-3-amine is sourced from PubChem (CID 2756351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).