About 2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile
2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile (PubChem CID 2756391) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile |
| PubChem CID | 2756391 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile |
| SMILES | Cc1[nH]c(N)c(C#N)c1C |
| InChI | InChI=1S/C7H9N3/c1-4-5(2)10-7(9)6(4)3-8/h10H,9H2,1-2H3 |
| InChIKey | QZVLATXNNPVXEJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile?
The IUPAC name of 2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile (CID 2756391) is 2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile.
What is the SMILES notation for 2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile?
The canonical SMILES for 2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile is Cc1[nH]c(N)c(C#N)c1C.
What is the InChIKey of 2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile?
The InChIKey is QZVLATXNNPVXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-4-5(2)10-7(9)6(4)3-8/h10H,9H2,1-2H3.
What are the key properties of 2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile?
2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile has a molecular weight of 135.17 g/mol, XLogP of 1.09, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-dimethyl-1H-pyrrole-3-carbonitrile is sourced from PubChem (CID 2756391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).