About 2-(2,6-dimethylmorpholin-4-yl)ethanamine
2-(2,6-dimethylmorpholin-4-yl)ethanamine (PubChem CID 2756423) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)ethanamine |
| PubChem CID | 2756423 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)ethanamine |
| SMILES | CC1CN(CCN)CC(C)O1 |
| InChI | InChI=1S/C8H18N2O/c1-7-5-10(4-3-9)6-8(2)11-7/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | GLOJLKCUVTZRFO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,6-dimethylmorpholin-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylmorpholin-4-yl)ethanamine?
The IUPAC name of 2-(2,6-dimethylmorpholin-4-yl)ethanamine (CID 2756423) is 2-(2,6-dimethylmorpholin-4-yl)ethanamine.
What is the SMILES notation for 2-(2,6-dimethylmorpholin-4-yl)ethanamine?
The canonical SMILES for 2-(2,6-dimethylmorpholin-4-yl)ethanamine is CC1CN(CCN)CC(C)O1.
What is the InChIKey of 2-(2,6-dimethylmorpholin-4-yl)ethanamine?
The InChIKey is GLOJLKCUVTZRFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-7-5-10(4-3-9)6-8(2)11-7/h7-8H,3-6,9H2,1-2H3.
What are the key properties of 2-(2,6-dimethylmorpholin-4-yl)ethanamine?
2-(2,6-dimethylmorpholin-4-yl)ethanamine has a molecular weight of 158.24 g/mol, XLogP of 0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylmorpholin-4-yl)ethanamine is sourced from PubChem (CID 2756423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).