C19H19N3O7S — CID 27564683
[2-(4-methyl-2-nitroanilino)-2-oxoethyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate (PubChem CID 27564683) has the molecular formula C19H19N3O7S and a molecular weight of 433.44 g/mol. Its IUPAC name is [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate.
| Compound Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
|---|---|
| PubChem CID | 27564683 |
| Molecular Formula | C19H19N3O7S |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] 1-methylsulfonyl-2,3-dihydroindole-5-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc3c(c2)CCN3S(C)(=O)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N3O7S/c1-12-3-5-15(17(9-12)22(25)26)20-18(23)11-29-19(24)14-4-6-16-13(10-14)7-8-21(16)30(2,27)28/h3-6,9-10H,7-8,11H2,1-2H3,(H,20,23) |
| InChIKey | WNLFFKPIAXMDCM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|