C8H8N4S — CID 2756527
5-N-phenyl-1,2,4-thiadiazole-3,5-diamine (PubChem CID 2756527) has the molecular formula C8H8N4S and a molecular weight of 192.25 g/mol. Its IUPAC name is 5-N-phenyl-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-phenyl-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 2756527 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 5-N-phenyl-1,2,4-thiadiazole-3,5-diamine |
| SMILES | Nc1nsc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C8H8N4S/c9-7-11-8(13-12-7)10-6-4-2-1-3-5-6/h1-5H,(H3,9,10,11,12) |
| InChIKey | VQILAUHHKYCEOS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |