About 1-benzylpiperazine;hydrochloride
1-benzylpiperazine;hydrochloride (PubChem CID 2756653) has the molecular formula C11H17ClN2
and a molecular weight of 212.72 g/mol. Its IUPAC name is 1-benzylpiperazine;hydrochloride.
Molecular Properties
| Compound Name | 1-benzylpiperazine;hydrochloride |
| PubChem CID | 2756653 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-benzylpiperazine;hydrochloride |
| SMILES | Cl.c1ccc(CN2CCNCC2)cc1 |
| InChI | InChI=1S/C11H16N2.ClH/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13;/h1-5,12H,6-10H2;1H |
| InChIKey | HRSFWIYFGGDGQO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzylpiperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpiperazine;hydrochloride?
The IUPAC name of 1-benzylpiperazine;hydrochloride (CID 2756653) is 1-benzylpiperazine;hydrochloride.
What is the SMILES notation for 1-benzylpiperazine;hydrochloride?
The canonical SMILES for 1-benzylpiperazine;hydrochloride is Cl.c1ccc(CN2CCNCC2)cc1.
What is the InChIKey of 1-benzylpiperazine;hydrochloride?
The InChIKey is HRSFWIYFGGDGQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2.ClH/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13;/h1-5,12H,6-10H2;1H.
What are the key properties of 1-benzylpiperazine;hydrochloride?
1-benzylpiperazine;hydrochloride has a molecular weight of 212.72 g/mol, XLogP of 1.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpiperazine;hydrochloride is sourced from PubChem (CID 2756653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).