C15H11Cl2N3O2 — CID 27567031
1-[(2R)-5-(3,6-dichloro-2-pyridinyl)-2-phenyl-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 27567031) has the molecular formula C15H11Cl2N3O2 and a molecular weight of 336.18 g/mol. Its IUPAC name is 1-[(2R)-5-(3,6-dichloro-2-pyridinyl)-2-phenyl-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[(2R)-5-(3,6-dichloro-2-pyridinyl)-2-phenyl-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 27567031 |
| Molecular Formula | C15H11Cl2N3O2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 1-[(2R)-5-(3,6-dichloro-2-pyridinyl)-2-phenyl-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2nc(Cl)ccc2Cl)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H11Cl2N3O2/c1-9(21)20-15(10-5-3-2-4-6-10)22-14(19-20)13-11(16)7-8-12(17)18-13/h2-8,15H,1H3/t15-/m1/s1 |
| InChIKey | IIRHEKKOUWWLKG-OAHLLOKOSA-N |
| XLogP | 3.63 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|