About 4-bromo-2,2-diphenylbutanoic acid
4-bromo-2,2-diphenylbutanoic acid (PubChem CID 2756959) has the molecular formula C16H15BrO2
and a molecular weight of 319.20 g/mol. Its IUPAC name is 4-bromo-2,2-diphenylbutanoic acid.
Molecular Properties
| Compound Name | 4-bromo-2,2-diphenylbutanoic acid |
| PubChem CID | 2756959 |
| Molecular Formula | C16H15BrO2 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 4-bromo-2,2-diphenylbutanoic acid |
| SMILES | O=C(O)C(CCBr)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15BrO2/c17-12-11-16(15(18)19,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,18,19) |
| InChIKey | GFIYIIRFIODLLU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,2-diphenylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,2-diphenylbutanoic acid?
The IUPAC name of 4-bromo-2,2-diphenylbutanoic acid (CID 2756959) is 4-bromo-2,2-diphenylbutanoic acid.
What is the SMILES notation for 4-bromo-2,2-diphenylbutanoic acid?
The canonical SMILES for 4-bromo-2,2-diphenylbutanoic acid is O=C(O)C(CCBr)(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-bromo-2,2-diphenylbutanoic acid?
The InChIKey is GFIYIIRFIODLLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrO2/c17-12-11-16(15(18)19,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,18,19).
What are the key properties of 4-bromo-2,2-diphenylbutanoic acid?
4-bromo-2,2-diphenylbutanoic acid has a molecular weight of 319.20 g/mol, XLogP of 3.84, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,2-diphenylbutanoic acid is sourced from PubChem (CID 2756959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).