About 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene
7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene (PubChem CID 2757027) has the molecular formula C12H14BrN
and a molecular weight of 252.15 g/mol. Its IUPAC name is 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene.
Molecular Properties
| Compound Name | 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
| PubChem CID | 2757027 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
| SMILES | Brc1cc2c3c(c1)CCCN3CCC2 |
| InChI | InChI=1S/C12H14BrN/c13-11-7-9-3-1-5-14-6-2-4-10(8-11)12(9)14/h7-8H,1-6H2 |
| InChIKey | PVTRKHJBWSTNOI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene?
The IUPAC name of 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene (CID 2757027) is 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene.
What is the SMILES notation for 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene?
The canonical SMILES for 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene is Brc1cc2c3c(c1)CCCN3CCC2.
What is the InChIKey of 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene?
The InChIKey is PVTRKHJBWSTNOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN/c13-11-7-9-3-1-5-14-6-2-4-10(8-11)12(9)14/h7-8H,1-6H2.
What are the key properties of 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene?
7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene has a molecular weight of 252.15 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene is sourced from PubChem (CID 2757027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).