C24H19N3O7S — CID 27572338
4-[(2S)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 27572338) has the molecular formula C24H19N3O7S and a molecular weight of 493.50 g/mol. Its IUPAC name is 4-[(2S)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[(2S)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 27572338 |
| Molecular Formula | C24H19N3O7S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 4-[(2S)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | Cc1ccc(C(O)=C2C(=O)C(=O)N(c3ccc(S(N)(=O)=O)cc3)[C@H]2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H19N3O7S/c1-14-2-4-16(5-3-14)22(28)20-21(15-6-8-18(9-7-15)27(31)32)26(24(30)23(20)29)17-10-12-19(13-11-17)35(25,33)34/h2-13,21,28H,1H3,(H2,25,33,34)/t21-/m0/s1 |
| InChIKey | MDSSSIOTNBRZAG-NRFANRHFSA-N |
| XLogP | 3.18 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|