About tert-butyl 2-piperazin-1-ylacetate;dihydrochloride
tert-butyl 2-piperazin-1-ylacetate;dihydrochloride (PubChem CID 2757325) has the molecular formula C10H22Cl2N2O2
and a molecular weight of 273.20 g/mol. Its IUPAC name is tert-butyl 2-piperazin-1-ylacetate;dihydrochloride.
Molecular Properties
| Compound Name | tert-butyl 2-piperazin-1-ylacetate;dihydrochloride |
| PubChem CID | 2757325 |
| Molecular Formula | C10H22Cl2N2O2 |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | tert-butyl 2-piperazin-1-ylacetate;dihydrochloride |
| SMILES | CC(C)(C)OC(=O)CN1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C10H20N2O2.2ClH/c1-10(2,3)14-9(13)8-12-6-4-11-5-7-12;;/h11H,4-8H2,1-3H3;2*1H |
| InChIKey | JNPMEYOZRVPYPP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-piperazin-1-ylacetate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-piperazin-1-ylacetate;dihydrochloride?
The IUPAC name of tert-butyl 2-piperazin-1-ylacetate;dihydrochloride (CID 2757325) is tert-butyl 2-piperazin-1-ylacetate;dihydrochloride.
What is the SMILES notation for tert-butyl 2-piperazin-1-ylacetate;dihydrochloride?
The canonical SMILES for tert-butyl 2-piperazin-1-ylacetate;dihydrochloride is CC(C)(C)OC(=O)CN1CCNCC1.Cl.Cl.
What is the InChIKey of tert-butyl 2-piperazin-1-ylacetate;dihydrochloride?
The InChIKey is JNPMEYOZRVPYPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2.2ClH/c1-10(2,3)14-9(13)8-12-6-4-11-5-7-12;;/h11H,4-8H2,1-3H3;2*1H.
What are the key properties of tert-butyl 2-piperazin-1-ylacetate;dihydrochloride?
tert-butyl 2-piperazin-1-ylacetate;dihydrochloride has a molecular weight of 273.20 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-piperazin-1-ylacetate;dihydrochloride is sourced from PubChem (CID 2757325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).