About 4-butylbenzenethiol
4-butylbenzenethiol (PubChem CID 2757347) has the molecular formula C10H14S
and a molecular weight of 166.29 g/mol. Its IUPAC name is 4-butylbenzenethiol.
Molecular Properties
| Compound Name | 4-butylbenzenethiol |
| PubChem CID | 2757347 |
| Molecular Formula | C10H14S |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 4-butylbenzenethiol |
| SMILES | CCCCc1ccc(S)cc1 |
| InChI | InChI=1S/C10H14S/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
| InChIKey | PVQZSZNJUBQKJW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-butylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylbenzenethiol?
The IUPAC name of 4-butylbenzenethiol (CID 2757347) is 4-butylbenzenethiol.
What is the SMILES notation for 4-butylbenzenethiol?
The canonical SMILES for 4-butylbenzenethiol is CCCCc1ccc(S)cc1.
What is the InChIKey of 4-butylbenzenethiol?
The InChIKey is PVQZSZNJUBQKJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14S/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3.
What are the key properties of 4-butylbenzenethiol?
4-butylbenzenethiol has a molecular weight of 166.29 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylbenzenethiol is sourced from PubChem (CID 2757347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).