C13H9ClF2O — CID 2757448
(3-chlorophenyl)-(3,5-difluorophenyl)methanol (PubChem CID 2757448) has the molecular formula C13H9ClF2O and a molecular weight of 254.66 g/mol. Its IUPAC name is (3-chlorophenyl)-(3,5-difluorophenyl)methanol.
| Compound Name | (3-chlorophenyl)-(3,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 2757448 |
| Molecular Formula | C13H9ClF2O |
| Molecular Weight | 254.66 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | (3-chlorophenyl)-(3,5-difluorophenyl)methanol |
| SMILES | OC(c1cc(F)cc(F)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H9ClF2O/c14-10-3-1-2-8(4-10)13(17)9-5-11(15)7-12(16)6-9/h1-7,13,17H |
| InChIKey | QMYZVECPIZFBQW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |