About 1-chloro-4-pentylbenzene
1-chloro-4-pentylbenzene (PubChem CID 2757748) has the molecular formula C11H15Cl
and a molecular weight of 182.69 g/mol. Its IUPAC name is 1-chloro-4-pentylbenzene.
Molecular Properties
| Compound Name | 1-chloro-4-pentylbenzene |
| PubChem CID | 2757748 |
| Molecular Formula | C11H15Cl |
| Molecular Weight | 182.69 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-chloro-4-pentylbenzene |
| SMILES | CCCCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H15Cl/c1-2-3-4-5-10-6-8-11(12)9-7-10/h6-9H,2-5H2,1H3 |
| InChIKey | GPRIKJSAAYMDPC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-pentylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-pentylbenzene?
The IUPAC name of 1-chloro-4-pentylbenzene (CID 2757748) is 1-chloro-4-pentylbenzene.
What is the SMILES notation for 1-chloro-4-pentylbenzene?
The canonical SMILES for 1-chloro-4-pentylbenzene is CCCCCc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-pentylbenzene?
The InChIKey is GPRIKJSAAYMDPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Cl/c1-2-3-4-5-10-6-8-11(12)9-7-10/h6-9H,2-5H2,1H3.
What are the key properties of 1-chloro-4-pentylbenzene?
1-chloro-4-pentylbenzene has a molecular weight of 182.69 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-pentylbenzene is sourced from PubChem (CID 2757748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).