C9H4ClF5O — CID 2757834
1-(4-chlorophenyl)-2,2,3,3,3-pentafluoropropan-1-one (PubChem CID 2757834) has the molecular formula C9H4ClF5O and a molecular weight of 258.57 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2,3,3,3-pentafluoropropan-1-one.
| Compound Name | 1-(4-chlorophenyl)-2,2,3,3,3-pentafluoropropan-1-one |
|---|---|
| PubChem CID | 2757834 |
| Molecular Formula | C9H4ClF5O |
| Molecular Weight | 258.57 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2,3,3,3-pentafluoropropan-1-one |
| SMILES | O=C(c1ccc(Cl)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4ClF5O/c10-6-3-1-5(2-4-6)7(16)8(11,12)9(13,14)15/h1-4H |
| InChIKey | SVCOUMOZVHFUSG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|