About 4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine
4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine (PubChem CID 2758029) has the molecular formula C11H14N4S
and a molecular weight of 234.33 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine |
| PubChem CID | 2758029 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine |
| SMILES | c1nc(N2CCCNCC2)c2ccsc2n1 |
| InChI | InChI=1S/C11H14N4S/c1-3-12-4-6-15(5-1)10-9-2-7-16-11(9)14-8-13-10/h2,7-8,12H,1,3-6H2 |
| InChIKey | BYVSVRKWGWNXLL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine?
The IUPAC name of 4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine (CID 2758029) is 4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine.
What is the SMILES notation for 4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine?
The canonical SMILES for 4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine is c1nc(N2CCCNCC2)c2ccsc2n1.
What is the InChIKey of 4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine?
The InChIKey is BYVSVRKWGWNXLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4S/c1-3-12-4-6-15(5-1)10-9-2-7-16-11(9)14-8-13-10/h2,7-8,12H,1,3-6H2.
What are the key properties of 4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine?
4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine has a molecular weight of 234.33 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-diazepan-1-yl)thieno[2,3-d]pyrimidine is sourced from PubChem (CID 2758029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).