About 3-(2,4-difluorophenyl)aniline
3-(2,4-difluorophenyl)aniline (PubChem CID 2758265) has the molecular formula C12H9F2N
and a molecular weight of 205.21 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)aniline.
Molecular Properties
| Compound Name | 3-(2,4-difluorophenyl)aniline |
| PubChem CID | 2758265 |
| Molecular Formula | C12H9F2N |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-(2,4-difluorophenyl)aniline |
| SMILES | Nc1cccc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C12H9F2N/c13-9-4-5-11(12(14)7-9)8-2-1-3-10(15)6-8/h1-7H,15H2 |
| InChIKey | WZTYCOKUYUEBMA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-difluorophenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-difluorophenyl)aniline?
The IUPAC name of 3-(2,4-difluorophenyl)aniline (CID 2758265) is 3-(2,4-difluorophenyl)aniline.
What is the SMILES notation for 3-(2,4-difluorophenyl)aniline?
The canonical SMILES for 3-(2,4-difluorophenyl)aniline is Nc1cccc(-c2ccc(F)cc2F)c1.
What is the InChIKey of 3-(2,4-difluorophenyl)aniline?
The InChIKey is WZTYCOKUYUEBMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2N/c13-9-4-5-11(12(14)7-9)8-2-1-3-10(15)6-8/h1-7H,15H2.
What are the key properties of 3-(2,4-difluorophenyl)aniline?
3-(2,4-difluorophenyl)aniline has a molecular weight of 205.21 g/mol, XLogP of 3.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-difluorophenyl)aniline is sourced from PubChem (CID 2758265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).