About 4,4-difluorobutan-1-amine;hydrochloride
4,4-difluorobutan-1-amine;hydrochloride (PubChem CID 2758267) has the molecular formula C4H10ClF2N
and a molecular weight of 145.58 g/mol. Its IUPAC name is 4,4-difluorobutan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 4,4-difluorobutan-1-amine;hydrochloride |
| PubChem CID | 2758267 |
| Molecular Formula | C4H10ClF2N |
| Molecular Weight | 145.58 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 4,4-difluorobutan-1-amine;hydrochloride |
| SMILES | Cl.NCCCC(F)F |
| InChI | InChI=1S/C4H9F2N.ClH/c5-4(6)2-1-3-7;/h4H,1-3,7H2;1H |
| InChIKey | BJGZOJBAVJHKSF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.58 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-difluorobutan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluorobutan-1-amine;hydrochloride?
The IUPAC name of 4,4-difluorobutan-1-amine;hydrochloride (CID 2758267) is 4,4-difluorobutan-1-amine;hydrochloride.
What is the SMILES notation for 4,4-difluorobutan-1-amine;hydrochloride?
The canonical SMILES for 4,4-difluorobutan-1-amine;hydrochloride is Cl.NCCCC(F)F.
What is the InChIKey of 4,4-difluorobutan-1-amine;hydrochloride?
The InChIKey is BJGZOJBAVJHKSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9F2N.ClH/c5-4(6)2-1-3-7;/h4H,1-3,7H2;1H.
What are the key properties of 4,4-difluorobutan-1-amine;hydrochloride?
4,4-difluorobutan-1-amine;hydrochloride has a molecular weight of 145.58 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluorobutan-1-amine;hydrochloride is sourced from PubChem (CID 2758267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).