C3H7F2N — CID 2758304
1,1-difluoro-N,N-dimethylmethanamine (PubChem CID 2758304) has the molecular formula C3H7F2N and a molecular weight of 95.09 g/mol. Its IUPAC name is 1,1-difluoro-N,N-dimethylmethanamine.
| Compound Name | 1,1-difluoro-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 2758304 |
| Molecular Formula | C3H7F2N |
| Molecular Weight | 95.09 g/mol |
| Exact Mass | 95.05 |
| IUPAC Name | 1,1-difluoro-N,N-dimethylmethanamine |
| SMILES | CN(C)C(F)F |
| InChI | InChI=1S/C3H7F2N/c1-6(2)3(4)5/h3H,1-2H3 |
| InChIKey | PULPCFLUVFWKAF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 95.09 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|