About 4,4-difluoropiperidine
4,4-difluoropiperidine (PubChem CID 2758352) has the molecular formula C5H9F2N
and a molecular weight of 121.13 g/mol. Its IUPAC name is 4,4-difluoropiperidine.
Molecular Properties
| Compound Name | 4,4-difluoropiperidine |
| PubChem CID | 2758352 |
| Molecular Formula | C5H9F2N |
| Molecular Weight | 121.13 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | 4,4-difluoropiperidine |
| SMILES | FC1(F)CCNCC1 |
| InChI | InChI=1S/C5H9F2N/c6-5(7)1-3-8-4-2-5/h8H,1-4H2 |
| InChIKey | MJOUJKDTBGXKIU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.13 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoropiperidine?
The IUPAC name of 4,4-difluoropiperidine (CID 2758352) is 4,4-difluoropiperidine.
What is the SMILES notation for 4,4-difluoropiperidine?
The canonical SMILES for 4,4-difluoropiperidine is FC1(F)CCNCC1.
What is the InChIKey of 4,4-difluoropiperidine?
The InChIKey is MJOUJKDTBGXKIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2N/c6-5(7)1-3-8-4-2-5/h8H,1-4H2.
What are the key properties of 4,4-difluoropiperidine?
4,4-difluoropiperidine has a molecular weight of 121.13 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoropiperidine is sourced from PubChem (CID 2758352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).