About 2-(3,4-dimethoxyphenyl)sulfonylethanol
2-(3,4-dimethoxyphenyl)sulfonylethanol (PubChem CID 2758479) has the molecular formula C10H14O5S
and a molecular weight of 246.28 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)sulfonylethanol.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)sulfonylethanol |
| PubChem CID | 2758479 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)sulfonylethanol |
| SMILES | COc1ccc(S(=O)(=O)CCO)cc1OC |
| InChI | InChI=1S/C10H14O5S/c1-14-9-4-3-8(7-10(9)15-2)16(12,13)6-5-11/h3-4,7,11H,5-6H2,1-2H3 |
| InChIKey | RDVUSDFEJBFMJF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dimethoxyphenyl)sulfonylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)sulfonylethanol?
The IUPAC name of 2-(3,4-dimethoxyphenyl)sulfonylethanol (CID 2758479) is 2-(3,4-dimethoxyphenyl)sulfonylethanol.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)sulfonylethanol?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)sulfonylethanol is COc1ccc(S(=O)(=O)CCO)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)sulfonylethanol?
The InChIKey is RDVUSDFEJBFMJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O5S/c1-14-9-4-3-8(7-10(9)15-2)16(12,13)6-5-11/h3-4,7,11H,5-6H2,1-2H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)sulfonylethanol?
2-(3,4-dimethoxyphenyl)sulfonylethanol has a molecular weight of 246.28 g/mol, XLogP of 0.47, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)sulfonylethanol is sourced from PubChem (CID 2758479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).