About 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine
4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine (PubChem CID 2758663) has the molecular formula C9H10N2S2
and a molecular weight of 210.33 g/mol. Its IUPAC name is 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine |
| PubChem CID | 2758663 |
| Molecular Formula | C9H10N2S2 |
| Molecular Weight | 210.33 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine |
| SMILES | Cc1cc(-c2csc(N)n2)c(C)s1 |
| InChI | InChI=1S/C9H10N2S2/c1-5-3-7(6(2)13-5)8-4-12-9(10)11-8/h3-4H,1-2H3,(H2,10,11) |
| InChIKey | SKDWLGWJNNTNGX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine (CID 2758663) is 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine is Cc1cc(-c2csc(N)n2)c(C)s1.
What is the InChIKey of 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine?
The InChIKey is SKDWLGWJNNTNGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2S2/c1-5-3-7(6(2)13-5)8-4-12-9(10)11-8/h3-4H,1-2H3,(H2,10,11).
What are the key properties of 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine?
4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine has a molecular weight of 210.33 g/mol, XLogP of 3.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 2758663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).