C12H6Cl4 — CID 27588
1,3-dichloro-2-(2,6-dichlorophenyl)benzene (PubChem CID 27588) has the molecular formula C12H6Cl4 and a molecular weight of 291.99 g/mol. Its IUPAC name is 1,3-dichloro-2-(2,6-dichlorophenyl)benzene.
| Compound Name | 1,3-dichloro-2-(2,6-dichlorophenyl)benzene |
|---|---|
| PubChem CID | 27588 |
| Molecular Formula | C12H6Cl4 |
| Molecular Weight | 291.99 g/mol |
| Exact Mass | 289.92 |
| IUPAC Name | 1,3-dichloro-2-(2,6-dichlorophenyl)benzene |
| SMILES | Clc1cccc(Cl)c1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H6Cl4/c13-7-3-1-4-8(14)11(7)12-9(15)5-2-6-10(12)16/h1-6H |
| InChIKey | PXAGFNRKXSYIHU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.99 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |