About 2-tert-Butoxycarbonylimino-3,3,3-trifluoro-propionic acid ethyl ester
2-tert-Butoxycarbonylimino-3,3,3-trifluoro-propionic acid ethyl ester (PubChem CID 2758811) has the molecular formula C10H14F3NO4
and a molecular weight of 269.22 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate.
Molecular Properties
| Compound Name | 2-tert-Butoxycarbonylimino-3,3,3-trifluoro-propionic acid ethyl ester |
| PubChem CID | 2758811 |
| Molecular Formula | C10H14F3NO4 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate |
| SMILES | CCOC(=O)C(=NC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO4/c1-5-17-7(15)6(10(11,12)13)14-8(16)18-9(2,3)4/h5H2,1-4H3 |
| InChIKey | XCDMKJZDUVQSMI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | 355 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-Butoxycarbonylimino-3,3,3-trifluoro-propionic acid ethyl ester with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-Butoxycarbonylimino-3,3,3-trifluoro-propionic acid ethyl ester?
The IUPAC name of 2-tert-Butoxycarbonylimino-3,3,3-trifluoro-propionic acid ethyl ester (CID 2758811) is ethyl 3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate.
What is the SMILES notation for 2-tert-Butoxycarbonylimino-3,3,3-trifluoro-propionic acid ethyl ester?
The canonical SMILES for 2-tert-Butoxycarbonylimino-3,3,3-trifluoro-propionic acid ethyl ester is CCOC(=O)C(=NC(=O)OC(C)(C)C)C(F)(F)F.
What is the InChIKey of 2-tert-Butoxycarbonylimino-3,3,3-trifluoro-propionic acid ethyl ester?
The InChIKey is XCDMKJZDUVQSMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3NO4/c1-5-17-7(15)6(10(11,12)13)14-8(16)18-9(2,3)4/h5H2,1-4H3.
What are the key properties of 2-tert-Butoxycarbonylimino-3,3,3-trifluoro-propionic acid ethyl ester?
2-tert-Butoxycarbonylimino-3,3,3-trifluoro-propionic acid ethyl ester has a molecular weight of 269.22 g/mol, XLogP of 2.90, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-Butoxycarbonylimino-3,3,3-trifluoro-propionic acid ethyl ester is sourced from PubChem (CID 2758811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).