About 2,3-dihydro-1,4-benzodioxine-6-thiol
2,3-dihydro-1,4-benzodioxine-6-thiol (PubChem CID 2758837) has the molecular formula C8H8O2S
and a molecular weight of 168.22 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxine-6-thiol.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4-benzodioxine-6-thiol |
| PubChem CID | 2758837 |
| Molecular Formula | C8H8O2S |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxine-6-thiol |
| SMILES | Sc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C8H8O2S/c11-6-1-2-7-8(5-6)10-4-3-9-7/h1-2,5,11H,3-4H2 |
| InChIKey | AJTXRGFHGWXIOZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1,4-benzodioxine-6-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4-benzodioxine-6-thiol?
The IUPAC name of 2,3-dihydro-1,4-benzodioxine-6-thiol (CID 2758837) is 2,3-dihydro-1,4-benzodioxine-6-thiol.
What is the SMILES notation for 2,3-dihydro-1,4-benzodioxine-6-thiol?
The canonical SMILES for 2,3-dihydro-1,4-benzodioxine-6-thiol is Sc1ccc2c(c1)OCCO2.
What is the InChIKey of 2,3-dihydro-1,4-benzodioxine-6-thiol?
The InChIKey is AJTXRGFHGWXIOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S/c11-6-1-2-7-8(5-6)10-4-3-9-7/h1-2,5,11H,3-4H2.
What are the key properties of 2,3-dihydro-1,4-benzodioxine-6-thiol?
2,3-dihydro-1,4-benzodioxine-6-thiol has a molecular weight of 168.22 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4-benzodioxine-6-thiol is sourced from PubChem (CID 2758837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).